Compound Information | SONAR Target prediction | Name: | Luteolin | Unique Identifier: | LAT006F11 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C15H10O6 | Molecular Weight: | 276.157 g/mol | X log p: | 13.108 (online calculus) | Lipinksi Failures | 1 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 6 | Rotatable Bond Count: | 1 | Canonical Smiles: | Oc1cc(O)c2C(=O)C=C(Oc2c1)c1ccc(O)c(O)c1 |
Species: |
4932 |
Condition: |
pdr18h |
Replicates: |
2 |
Raw OD Value: r im |
0.6019±0.0290621 |
Normalized OD Score: sc h |
0.9856±0.00952642 |
Z-Score: |
-0.2565±0.245185 |
p-Value: |
0.800528 |
Z-Factor: |
-21.9868 |
Fitness Defect: |
0.2225 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | LATCA | Plate Number and Position: | 6|F11 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.40 Celcius | Date: | 2007-03-08 YYYY-MM-DD | Plate CH Control (+): | 0.04025±0.00231 | Plate DMSO Control (-): | 0.6212±0.01753 | Plate Z-Factor: | 0.9250 |
| png ps pdf |
DBLink | Rows returned: 2 | |
5280445 |
2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-chromen-4-one |
5281701 |
5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)chromen-4-one |
internal high similarity DBLink | Rows returned: 4 | |
active | Cluster 1884 | Additional Members: 20 | Rows returned: 6 | |
|