| Compound Information | SONAR Target prediction | | Name: | PD 98,059 | | Unique Identifier: | LAT006E05 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C16H13NO3 | | Molecular Weight: | 254.176 g/mol | | X log p: | 16.42 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 35.53 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 2 | | Canonical Smiles: | COc1cccc(c1N)C1Oc2ccccc2C(=O)C=1 |
| Species: |
4932 |
| Condition: |
wt18h |
| Replicates: |
2 |
| Raw OD Value: r im |
0.5934±0.0403051 |
| Normalized OD Score: sc h |
0.7142±0.0408353 |
| Z-Score: |
-7.9749±0.262356 |
| p-Value: |
0.0000000000000035346 |
| Z-Factor: |
0.289491 |
| Fitness Defect: |
33.2762 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | LATCA | | Plate Number and Position: | 6|E5 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.10 Celcius | | Date: | 2007-02-28 YYYY-MM-DD | | Plate CH Control (+): | 0.039349999999999996±0.00143 | | Plate DMSO Control (-): | 0.79165±0.02175 | | Plate Z-Factor: | 0.8690 |
|  png
ps
pdf |
| DBLink | Rows returned: 1 | |
| 4713 |
2-(2-amino-3-methoxy-phenyl)chromen-4-one |
| internal high similarity DBLink | Rows returned: 1 | |
|
