| Compound Information | SONAR Target prediction | | Name: | Beta-Carotene | | Unique Identifier: | LAT006C08 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C40H56 | | Molecular Weight: | 480.428 g/mol | | X log p: | 30.392 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 0 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 0 | | Rotatable Bond Count: | 10 | | Canonical Smiles: | CC1CCCC(C)(C)C=1C=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)
C | | Generic_name: | ALL-TRANS AXEROPHTHENE | | Chemical_iupac_name: | ALL-TRANS AXEROPHTHENE | | Drug_type: | Experimental | | Drugbank_id: | EXPT00602 | | Logp: | 5.62 | | Drug_category: | Retinol Binding Protein Complexed With Axero inhibitor | | Organisms_affected: | -1 |
| Species: |
4932 |
| Condition: |
wt24h |
| Replicates: |
2 |
| Raw OD Value: r im |
0.8068±0.0195161 |
| Normalized OD Score: sc h |
1.0043±0.0172344 |
| Z-Score: |
0.4576±0.612175 |
| p-Value: |
0.676728 |
| Z-Factor: |
-8.42942 |
| Fitness Defect: |
0.3905 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | LATCA | | Plate Number and Position: | 6|C8 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.40 Celcius | | Date: | 2007-02-28 YYYY-MM-DD | | Plate CH Control (+): | 0.03945±0.00164 | | Plate DMSO Control (-): | 0.78535±0.01358 | | Plate Z-Factor: | 0.9421 |
|  png
ps
pdf |
| 11823059 |
lithium; aluminum(+3) cation; butane; carbanide;
1,3,3-trimethyl-2-[(1E)-3-methylbuta-1,3-dienyl]cyclohexene |
| 11823060 |
1,3,3-trimethyl-2-[(1E)-3-methylbuta-1,3-dienyl]cyclohexene |
| 11830192 |
1-[(E)-2-(1-cyclohexenyl)ethenyl]cyclohexene |
| 11830772 |
n/a |
| 16061225 |
(12E,14E,16Z,18E,20E)-2,6,10,14,19,23,27,31-octamethyldotriaconta-2,12,14,16,18,20,30-heptaene |
| 16061276 |
(1E,3E,5E,7E,9E,11E,13E,15E,17E,19E)-3,7,12,16,20,24-hexamethyl-1-(2,6,6-trimethyl-1-cyclohexenyl)pentac
osa-1,3,5,7,9,11,13,15,17,19-decaene |
| internal high similarity DBLink | Rows returned: 1 | |
| active | Cluster 820 | Additional Members: 15 | Rows returned: 3 | |
|
