Compound Information | SONAR Target prediction | Name: | Beta-Carotene | Unique Identifier: | LAT006C08 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C40H56 | Molecular Weight: | 480.428 g/mol | X log p: | 30.392 (online calculus) | Lipinksi Failures | 1 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 0 | Rotatable Bond Count: | 10 | Canonical Smiles: | CC1CCCC(C)(C)C=1C=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C) C | Generic_name: | ALL-TRANS AXEROPHTHENE | Chemical_iupac_name: | ALL-TRANS AXEROPHTHENE | Drug_type: | Experimental | Drugbank_id: | EXPT00602 | Logp: | 5.62 | Drug_category: | Retinol Binding Protein Complexed With Axero inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
pdr22h |
Replicates: |
2 |
Raw OD Value: r im |
0.6738±0.025668 |
Normalized OD Score: sc h |
1.0040±0.0299308 |
Z-Score: |
0.3215±1.06509 |
p-Value: |
0.47427 |
Z-Factor: |
-92.8393 |
Fitness Defect: |
0.746 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | LATCA | Plate Number and Position: | 6|C8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.00 Celcius | Date: | 2007-03-08 YYYY-MM-DD | Plate CH Control (+): | 0.041575±0.00220 | Plate DMSO Control (-): | 0.6727000000000001±0.01163 | Plate Z-Factor: | 0.9515 |
| png ps pdf |
11823059 |
lithium; aluminum(+3) cation; butane; carbanide; 1,3,3-trimethyl-2-[(1E)-3-methylbuta-1,3-dienyl]cyclohexene |
11823060 |
1,3,3-trimethyl-2-[(1E)-3-methylbuta-1,3-dienyl]cyclohexene |
11830192 |
1-[(E)-2-(1-cyclohexenyl)ethenyl]cyclohexene |
11830772 |
n/a |
16061225 |
(12E,14E,16Z,18E,20E)-2,6,10,14,19,23,27,31-octamethyldotriaconta-2,12,14,16,18,20,30-heptaene |
16061276 |
(1E,3E,5E,7E,9E,11E,13E,15E,17E,19E)-3,7,12,16,20,24-hexamethyl-1-(2,6,6-trimethyl-1-cyclohexenyl)pentac osa-1,3,5,7,9,11,13,15,17,19-decaene |
internal high similarity DBLink | Rows returned: 1 | |
active | Cluster 820 | Additional Members: 15 | Rows returned: 3 | |
|