Compound Information | SONAR Target prediction | Name: | Beta-Carotene | Unique Identifier: | LAT006C08 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C40H56 | Molecular Weight: | 480.428 g/mol | X log p: | 30.392 (online calculus) | Lipinksi Failures | 1 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 0 | Rotatable Bond Count: | 10 | Canonical Smiles: | CC1CCCC(C)(C)C=1C=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C) C | Generic_name: | ALL-TRANS AXEROPHTHENE | Chemical_iupac_name: | ALL-TRANS AXEROPHTHENE | Drug_type: | Experimental | Drugbank_id: | EXPT00602 | Logp: | 5.62 | Drug_category: | Retinol Binding Protein Complexed With Axero inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
wt18h |
Replicates: |
2 |
Raw OD Value: r im |
0.8280±0.0108187 |
Normalized OD Score: sc h |
1.0030±0.00248679 |
Z-Score: |
0.1411±0.0752058 |
p-Value: |
0.887926 |
Z-Factor: |
-105.888 |
Fitness Defect: |
0.1189 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | LATCA | Plate Number and Position: | 6|C8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.10 Celcius | Date: | 2007-02-28 YYYY-MM-DD | Plate CH Control (+): | 0.039349999999999996±0.00143 | Plate DMSO Control (-): | 0.79165±0.02175 | Plate Z-Factor: | 0.8690 |
| png ps pdf |
11147166 |
(1E,3E,5E,7E,9E,11E,13E,15E,17E,19E,21E,23E,25E,27E,29E,31E,33E)-3,7,11,15,20,24,28,32-octamethyl-1,34-b is(2,6,6-trimethyl-1-cyclohexenyl)tetratriaconta-1,3,5,7,9,11,13,15,17,19,21,23,25,27,29,31,33-heptadeca ene |
11253876 |
(1E,3E,5E)-3,7-dimethyl-1-(2,6,6-trimethyl-1-cyclohexenyl)octa-1,3,5,7-tetraene |
11261360 |
(1E,3E,5E,7E,9E,11E,13E,15E,17E)-3,7,12,16-tetramethyl-1,18-bis(2,6,6-trimethyl-1-cyclohexenyl)nonadeca- 1,3,5,7,9,11,13,15,17-nonaene |
11389688 |
(1R,5R)-4-[(1E)-buta-1,3-dienyl]-7,7-dimethyl-bicyclo[3.1.1]hept-3-ene |
11541284 |
(1Z,3Z,5Z,7Z)-1,2,3,4,5,6,7,8-octabutylcycloocta-1,3,5,7-tetraene |
11763267 |
(1E,3E,5E,7E,9E,11E,13E,15E,17E)-3,7,12,16-tetramethyl-1,18-bis(2,6,6-trimethyl-1-cyclohexenyl)-5,6-ditr itio-octadeca-1,3,5,7,9,11,13,15,17-nonaene |
internal high similarity DBLink | Rows returned: 1 | |
active | Cluster 820 | Additional Members: 15 | Rows returned: 3 | |
|