| Compound Information | SONAR Target prediction | | Name: | Beta-Carotene | | Unique Identifier: | LAT006C08 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C40H56 | | Molecular Weight: | 480.428 g/mol | | X log p: | 30.392 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 0 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 0 | | Rotatable Bond Count: | 10 | | Canonical Smiles: | CC1CCCC(C)(C)C=1C=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C) C | | Generic_name: | ALL-TRANS AXEROPHTHENE | | Chemical_iupac_name: | ALL-TRANS AXEROPHTHENE | | Drug_type: | Experimental | | Drugbank_id: | EXPT00602 | | Logp: | 5.62 | | Drug_category: | Retinol Binding Protein Complexed With Axero inhibitor | | Organisms_affected: | -1 |
| Species: |
4932 |
| Condition: |
pdr18h |
| Replicates: |
2 |
| Raw OD Value: r im |
0.5860±0.00643467 |
| Normalized OD Score: sc h |
0.9652±0.0114276 |
| Z-Score: |
-0.8556±0.390853 |
| p-Value: |
0.410058 |
| Z-Factor: |
-3.67996 |
| Fitness Defect: |
0.8915 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | LATCA | | Plate Number and Position: | 6|C8 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.40 Celcius | | Date: | 2007-03-08 YYYY-MM-DD | | Plate CH Control (+): | 0.04025±0.00231 | | Plate DMSO Control (-): | 0.6212±0.01753 | | Plate Z-Factor: | 0.9250 |
| png ps pdf |
| 10703304 |
1-[(Z)-2-(1-cyclohexenyl)ethenyl]-2-methyl-cyclohexene |
| 10768869 |
(1E,3E,5E,7E,9E,11E,13E,15E,17E)-3,7,12,16-tetramethyl-1,18-bis(2,6,6-trimethyl-1-cyclohexenyl)octadeca- 1,3,5,7,9,11,13,15,17-nonaene |
| 10833392 |
(1S,6S)-1-[2-[(Z)-2-[2-[(1R,6R)-norcaran-1-yl]-1-cyclohexenyl]ethenyl]-1-cyclohexenyl]norcarane |
| 10901694 |
(1E,3E,5E)-3,6,7-trimethyl-1-(2,6,6-trimethyl-1-cyclohexenyl)octa-1,3,5,7-tetraene |
| 10944614 |
(1E,3E,5E)-3-methyl-1-(2,6,6-trimethyl-1-cyclohexenyl)octa-1,3,5,7-tetraene |
| 11004423 |
n/a |
| internal high similarity DBLink | Rows returned: 1 | |
| active | Cluster 820 | Additional Members: 15 | Rows returned: 3 | |
|