| Compound Information | SONAR Target prediction | | Name: | Mevinolin | | Unique Identifier: | LAT006B08 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C24H36O5 | | Molecular Weight: | 368.254 g/mol | | X log p: | 6.185 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 52.6 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 5 | | Rotatable Bond Count: | 7 | | Canonical Smiles: | CCC(C)C(=O)OC1CC(C)C=C2C=CC(C)C(CCC3CC(O)CC(=O)O3)C12 | | Generic_name: | Simvastatin | | Chemical_iupac_name: | [8-[2-(4-hydroxy-6-oxo-tetrahydropyran-2-yl)ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahyd ronaphthalen-1-yl]2,2-dimethylbutanoate | | Drug_type: | Approved Drug | | Pharmgkb_id: | PA451363 | | Kegg_compound_id: | D00434 | | Drugbank_id: | APRD00104 | | Melting_point: | 135-138oC | | H2o_solubility: | 0.76 mg/L | | Logp: | 4.937 | | Cas_registry_number: | 79902-63-9 | | Drug_category: | Antilipemic Agents; Anticholesteremic Agents; HMG-CoA Reductase Inhibitors; ATC:C10AA01 | | Indication: | For the treatment of hypercholesterolemia. | | Pharmacology: | Simvastatin, the methylated form of lovastatin, is an oral antilipemic agent which inhibits HMG-CoA reductase. simvastatin is used in the treatment of primary hypercholesterolemia and is effective in reducing total and LDL-cholesterol as well as plasma triglycerides and apolipoprotein B. | | Mechanism_of_action: | The 6-membered lactone ring of simvastatin is hydrolyzed in vivo to generate mevinolinic acid, an active metabolite structurally similar to HMG-CoA (hydroxymethylglutaryl CoA). Once hydrolyzed, simvastatin competes with HMG-CoA for HMG-CoA reductase, a hepatic microsomal enzyme. Interference with the activity of this enzyme reduces the quantity of mevalonic acid, a precursor of cholesterol. | | Organisms_affected: | Humans and other mammals |
| Species: |
4932 |
| Condition: |
pdr24h |
| Replicates: |
2 |
| Raw OD Value: r im |
0.5772±0.0174655 |
| Normalized OD Score: sc h |
0.8374±0.0141112 |
| Z-Score: |
-6.8800±0.427089 |
| p-Value: |
0.0000000000241906 |
| Z-Factor: |
0.206618 |
| Fitness Defect: |
24.4451 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | LATCA | | Plate Number and Position: | 6|B8 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 27.10 Celcius | | Date: | 2007-03-08 YYYY-MM-DD | | Plate CH Control (+): | 0.040925±0.00232 | | Plate DMSO Control (-): | 0.659375±0.01975 | | Plate Z-Factor: | 0.9091 |
| png ps pdf |
| 10068987 |
[(1S,7R,8S,8aR)-8-[2-[(2S,4S)-4-hydroxy-6-oxo-oxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen -1-yl] (2S)-2-methylbutanoate |
| 10158599 |
sodium (2R,4R)-2-[2-[(1S,2R,8S,8aR)-2-methyl-8-[(2S)-2-methylbutanoyl]oxy-1,2,6,7,8,8a-hexahydronaphthalen-1-yl ]ethyl]-6-oxo-oxan-4-olate |
| 10159945 |
[(1S,3R,7R)-8-[2-[(4R,5S)-4-hydroxy-5-methyl-6-oxo-oxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydron aphthalen-1-yl] 2,2-dimethylbutanoate |
| 10159946 |
[(1S,3R,7R)-8-[2-[(4R,5R)-4-hydroxy-5-methyl-6-oxo-oxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydron aphthalen-1-yl] 2,2-dimethylbutanoate |
| 10234573 |
calcium (2R,4R)-2-[2-[(1S,2R,6R,8S)-2,6-dimethyl-8-[(2S)-2-methylbutanoyl]oxy-1,2,6,7,8,8a-hexahydronaphthalen-1 -yl]ethyl]-6-oxo-oxan-4-olate |
| 10253111 |
[(1S,2S,3S,7R,8S,8aR)-2-(hydroxymethyl)-8-[2-[(2R,4R)-4-hydroxy-6-oxo-oxan-2-yl]ethyl]-3,7-dimethyl-1,2, 3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
| internal high similarity DBLink | Rows returned: 7 | 1 2 Next >> |
| active | Cluster 2780 | Additional Members: 9 | Rows returned: 5 | |
|