| Compound Information | SONAR Target prediction |
| Name: | Guanosine |
| Unique Identifier: | LAT004G08 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C10H13N5O5 |
| Molecular Weight: | 270.138 g/mol |
| X log p: | 0.609 (online calculus) |
| Lipinksi Failures | 0 |
| TPSA | 54.26 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 10 |
| Rotatable Bond Count: | 2 |
| Canonical Smiles: | NC1NC(=O)c2ncn(C3OC(CO)C(O)C3O)c2N=1 |
| Found: 5 nonactive as graph: single | with analogs | 1 2 3 4 5 Next >> |
| Species: | 4932 |
| Condition: | pdr18h |
| Replicates: | 2 |
| Raw OD Value: r im | 0.6073±0.025668 |
| Normalized OD Score: sc h | 0.9645±0.0253916 |
| Z-Score: | -0.8377±0.648702 |
| p-Value: | 0.449766 |
| Z-Factor: | -12.4256 |
| Fitness Defect: | 0.799 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 0 |
| internal high similarity DBLink | Rows returned: 0 |
| active | Cluster 590 | Additional Members: 7 | Rows returned: 1 |
| SPE01503603 | 0 |
Service provided by the
Mike Tyers Laboratory