Compound Information | SONAR Target prediction | Name: | Win 62,577 | Unique Identifier: | LAT004C08 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C28H30N4O | Molecular Weight: | 409.334 g/mol | X log p: | 11.371 (online calculus) | Lipinksi Failures | 1 | TPSA | 51.75 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC12CC3=Cn4c(nc5ccccc45)N=C3C=C1CCC1C2CCC2(C)C1CCC2(O)C#N |
Species: |
4932 |
Condition: |
pdr24h |
Replicates: |
2 |
Raw OD Value: r im |
0.0936±0.0147785 |
Normalized OD Score: sc h |
0.1370±0.0228562 |
Z-Score: |
-36.9735±0.103373 |
p-Value: |
0 |
Z-Factor: |
-0.424534 |
Fitness Defect: |
INF |
Bioactivity Statement: |
Toxic |
Experimental Conditions | | Library: | LATCA | Plate Number and Position: | 4|C8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.10 Celcius | Date: | 2007-03-08 YYYY-MM-DD | Plate CH Control (+): | 0.040925±0.00269 | Plate DMSO Control (-): | 0.6677249999999999±0.22269 | Plate Z-Factor: | -0.0779 |
| png ps pdf |
DBLink | Rows returned: 2 | |
internal high similarity DBLink | Rows returned: 1 | |
nonactive | Cluster 7793 | Additional Members: 6 | Rows returned: 5 | |
|