| Compound Information | SONAR Target prediction |
| Name: | Minocycline Hydrochloride |
| Unique Identifier: | LAT004C03 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C24ClH29N2O7 |
| Molecular Weight: | 465.735 g/mol |
| X log p: | 4.163 (online calculus) |
| Lipinksi Failures | 0 |
| TPSA | 54.45 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 9 |
| Rotatable Bond Count: | 3 |
| Canonical Smiles: | Cl.CC(C)C1C2CC3Cc4c(ccc(O)c4C(=O)C3=C(O)C2(O)C(=O)C(C(N)=O)=C1O)N(C)C |
| Found: 5 nonactive as graph: single | with analogs | 1 2 3 4 5 Next >> |
| Species: | 4932 |
| Condition: | pdr18h |
| Replicates: | 2 |
| Raw OD Value: r im | 0.6768±0.0124451 |
| Normalized OD Score: sc h | 1.0751±0.00262098 |
| Z-Score: | 2.2674±0.240848 |
| p-Value: | 0.0253816 |
| Z-Factor: | -4.26371 |
| Fitness Defect: | 3.6737 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 0 |
| internal high similarity DBLink | Rows returned: 1 |
| LOPAC 00607 | 1.0000 |
| active | Cluster 12393 | Additional Members: 20 | Rows returned: 4 |
| Prest1244 | 0.490196078431373 |
| Prest1045 | 0.452631578947368 |
| SPE01505684 | 0.452631578947368 |
| Prest60 | 0 |
Service provided by the
Mike Tyers Laboratory