Compound Information | SONAR Target prediction | Name: | Cholic Acid | Unique Identifier: | LAT004A10 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C24H40O5 | Molecular Weight: | 372.286 g/mol | X log p: | -1.301 (online calculus) | Lipinksi Failures | 0 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 4 | Canonical Smiles: | CC(CCC(O)=O)C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CC(O)C12C | Generic_name: | CHOLIC ACID | Chemical_iupac_name: | CHOLIC ACID | Drug_type: | Experimental | Kegg_compound_id: | C00695 | Drugbank_id: | EXPT00906 | Logp: | 2.818 | Cas_registry_number: | 81-25-4 | Drug_category: | Estrogen-Related Receptor Gamma inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
pdr18h |
Replicates: |
2 |
Raw OD Value: r im |
0.6400±0.00516188 |
Normalized OD Score: sc h |
1.0167±0.00801646 |
Z-Score: |
0.6031±0.184638 |
p-Value: |
0.549828 |
Z-Factor: |
-6.71816 |
Fitness Defect: |
0.5981 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | LATCA | Plate Number and Position: | 4|A10 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.20 Celcius | Date: | 2007-03-08 YYYY-MM-DD | Plate CH Control (+): | 0.040825±0.00277 | Plate DMSO Control (-): | 0.640525±0.21231 | Plate Z-Factor: | -0.0729 |
| png ps pdf |
181459 |
(5R)-5-[(3R,5S,7R,8S,9S,10R,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17- tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]hexanoic acid |
192254 |
(3R)-3-[(3R,5S,7S,8S,9S,10R,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17- tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoic acid |
196679 |
(4R)-4-[(3R,5S,7S,8S,9S,10R,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17- tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methyl-pentanoic acid |
221493 |
(4R)-4-[(3R,5S,7R,8R,9S,10S,12S,13R,14S,17R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,1 5,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
313228 |
acetic acid; 4-(3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phe nanthren-17-yl)pentanoic acid |
376829 |
4-[(5S,7S,8R,10S,13R,17R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahy dro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
internal high similarity DBLink | Rows returned: 5 | |
nonactive | Cluster 10691 | Additional Members: 8 | Rows returned: 4 | |
|