| Compound Information | SONAR Target prediction | | Name: | Cholic Acid | | Unique Identifier: | LAT004A10 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C24H40O5 | | Molecular Weight: | 372.286 g/mol | | X log p: | -1.301 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 17.07 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 5 | | Rotatable Bond Count: | 4 | | Canonical Smiles: | CC(CCC(O)=O)C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CC(O)C12C | | Generic_name: | CHOLIC ACID | | Chemical_iupac_name: | CHOLIC ACID | | Drug_type: | Experimental | | Kegg_compound_id: | C00695 | | Drugbank_id: | EXPT00906 | | Logp: | 2.818 | | Cas_registry_number: | 81-25-4 | | Drug_category: | Estrogen-Related Receptor Gamma inhibitor | | Organisms_affected: | -1 |
| Species: |
4932 |
| Condition: |
wt18h |
| Replicates: |
2 |
| Raw OD Value: r im |
0.8203±0.00883884 |
| Normalized OD Score: sc h |
1.0429±0.00589509 |
| Z-Score: |
1.2691±0.0240741 |
| p-Value: |
0.204466 |
| Z-Factor: |
-5.48766 |
| Fitness Defect: |
1.5874 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | LATCA | | Plate Number and Position: | 4|A10 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.80 Celcius | | Date: | 2007-02-28 YYYY-MM-DD | | Plate CH Control (+): | 0.040675±0.00207 | | Plate DMSO Control (-): | 0.8063999999999999±0.27232 | | Plate Z-Factor: | -0.0698 |
| png ps pdf |
| 7173550 |
(4S)-4-[(3R,5S,7R,8S,9R,10R,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17- tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| 7173551 |
(4S)-4-[(3R,5S,7R,8S,9R,10R,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17- tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
| 7173552 |
(4S)-4-[(3R,5S,7R,8S,9R,10R,13R,14R,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17- tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| 7173553 |
(4S)-4-[(3R,5S,7R,8S,9R,10R,13R,14R,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17- tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
| 7173554 |
(4S)-4-[(3R,5S,7R,8S,9S,10R,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17- tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| 7173555 |
(4S)-4-[(3R,5S,7R,8S,9S,10R,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17- tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
| internal high similarity DBLink | Rows returned: 5 | |
| active | Cluster 10691 | Additional Members: 8 | Rows returned: 0 | |
|