| Compound Information | SONAR Target prediction |
| Name: | Parthenolide |
| Unique Identifier: | LAT003F02 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C15H20O3 |
| Molecular Weight: | 228.159 g/mol |
| X log p: | 2.151 (online calculus) |
| Lipinksi Failures | 0 |
| TPSA | 38.83 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 3 |
| Rotatable Bond Count: | 0 |
| Canonical Smiles: | CC1CCC2C(OC(=O)C2=C)C2OC2(C)CCC=1 |
| Found: 3 active | as graph: single | with analogs | 1 2 3 Next >> |
| Species: | 4932 |
| Condition: | pdr18h |
| Replicates: | 2 |
| Raw OD Value: r im | 0.4819±0.0299813 |
| Normalized OD Score: sc h | 0.7667±0.0366731 |
| Z-Score: | -6.4169±0.545971 |
| p-Value: | 0.000000000820516 |
| Z-Factor: | 0.229542 |
| Fitness Defect: | 20.9211 |
| Bioactivity Statement: | Active |
| ps |
| DBLink | Rows returned: 16 | << Back 1 2 3 |
| 6708471 |
| 6746983 |
| 7251185 |
| 16057519 |
| internal high similarity DBLink | Rows returned: 4 |
| BIOMOL 317 | 1.0000 |
| LOPAC 01123 | 1.0000 |
| Prest876 | 1.0000 |
| SPE01503640 | 1.0000 |
| active | Cluster 2298 | Additional Members: 5 | Rows returned: 2 |
| SPE01503640 | 0 |
| LOPAC 01123 | 0 |
Service provided by the
Mike Tyers Laboratory