Compound Information | SONAR Target prediction | Name: | Mycophenolic Acid | Unique Identifier: | LAT003C02 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C17H20O6 | Molecular Weight: | 300.178 g/mol | X log p: | 2.141 (online calculus) | Lipinksi Failures | 0 | TPSA | 52.6 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 6 | Rotatable Bond Count: | 6 | Canonical Smiles: | COc1c(C)c2COC(=O)c2c(O)c1CC=C(C)CCC(O)=O | Generic_name: | 6-(1,3-DIHYDRO-7-HYDROXY-5-METHOXY-4-MET | Chemical_iupac_name: | MYCOPHENOLIC ACID | Drug_type: | Experimental | Drugbank_id: | EXPT02208 | Drug_category: | Inosine-5--Monophosphate Dehydrogenase 2 inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
pdr18h |
Replicates: |
2 |
Raw OD Value: r im |
0.3855±0.0191626 |
Normalized OD Score: sc h |
0.6133±0.0216639 |
Z-Score: |
-10.7708±0.205662 |
p-Value: |
1.18366e-26 |
Z-Factor: |
0.653935 |
Fitness Defect: |
59.6986 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | LATCA | Plate Number and Position: | 3|C2 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.20 Celcius | Date: | 2007-03-08 YYYY-MM-DD | Plate CH Control (+): | 0.039675±0.00190 | Plate DMSO Control (-): | 0.63455±0.01440 | Plate Z-Factor: | 0.9167 |
| png ps pdf |
10403838 |
(E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-isobenzofuran-5-yl)-4-methyl-hex-4-enoic acid |
10496923 |
(E,2S)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-isobenzofuran-5-yl)-2,4-dimethyl-hex-4-enoic acid |
11411441 |
zinc (E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-isobenzofuran-5-yl)-4-methyl-hex-4-enoate |
11468938 |
bismuth (E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-isobenzofuran-5-yl)-4-methyl-hex-4-enoate |
internal high similarity DBLink | Rows returned: 2 | |
active | Cluster 2762 | Additional Members: 4 | Rows returned: 1 | |
|