| Compound Information | SONAR Target prediction |
| Name: | Mycophenolic Acid |
| Unique Identifier: | LAT003C02 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C17H20O6 |
| Molecular Weight: | 300.178 g/mol |
| X log p: | 2.141 (online calculus) |
| Lipinksi Failures | 0 |
| TPSA | 52.6 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 6 |
| Rotatable Bond Count: | 6 |
| Canonical Smiles: | COc1c(C)c2COC(=O)c2c(O)c1CC=C(C)CCC(O)=O |
| Generic_name: | 6-(1,3-DIHYDRO-7-HYDROXY-5-METHOXY-4-MET |
| Chemical_iupac_name: | MYCOPHENOLIC ACID |
| Drug_type: | Experimental |
| Drugbank_id: | EXPT02208 |
| Drug_category: | Inosine-5--Monophosphate Dehydrogenase 2 inhibitor |
| Organisms_affected: | -1 |
| Found: 3 active | as graph: single | with analogs | 1 2 3 Next >> |
| Species: | 4932 |
| Condition: | pdr18h |
| Replicates: | 2 |
| Raw OD Value: r im | 0.3855±0.0191626 |
| Normalized OD Score: sc h | 0.6133±0.0216639 |
| Z-Score: | -10.7708±0.205662 |
| p-Value: | 1.18366e-26 |
| Z-Factor: | 0.653935 |
| Fitness Defect: | 59.6986 |
| Bioactivity Statement: | Active |
| ps |
| DBLink | Rows returned: 10 | 1 2 Next >> |
| 4272 | 6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-isobenzofuran-5-yl)-4-methyl-hex-4-enoic acid |
| 446541 | (E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-isobenzofuran-5-yl)-4-methyl-hex-4-enoic acid |
| 671222 | (E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-isobenzofuran-5-yl)-4-methyl-hex-4-enoic acid |
| 6433817 | sodium (E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-isobenzofuran-5-yl)-4-methyl-hex-4-enoate |
| 6444343 | disodium (E)-6-(6-methoxy-7-methyl-4-oxido-3-oxo-1H-isobenzofuran-5-yl)-4-methyl-hex-4-enoate |
| 6918995 | (E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-isobenzofuran-5-yl)-4-methyl-hex-4-enoate |
| internal high similarity DBLink | Rows returned: 2 |
| Prest817 | 1.0000 |
| SPE01500674 | 1.0000 |
| active | Cluster 2762 | Additional Members: 4 | Rows returned: 1 |
| SPE01500674 | 0 |
Service provided by the
Mike Tyers Laboratory