| Compound Information | SONAR Target prediction |  | Name: | 2-Chloroadenosine |  | Unique Identifier: | LAT003B08  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C10ClH12N5O4 |  | Molecular Weight: | 289.591 g/mol |  | X log p: | 1.286  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 49.55 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 9 |  | Rotatable Bond Count: | 2 |  | Canonical Smiles: | Nc1nc(Cl)nc2n(cnc12)C1OC(CO)C(O)C1O |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		wt24h | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.8210±0.01492 | 
	 
	
		| Normalized OD Score: sc h | 
		1.0091±0.00473814 | 
	 
	
		| Z-Score: | 
		0.6161±0.0923672 | 
	 
	
		| p-Value: | 
		0.538688 | 
	 
	
		| Z-Factor: | 
		-4.89451 | 
	 
	
		| Fitness Defect: | 
		0.6186 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | LATCA |  | Plate Number and Position: | 3|B8 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 25.40 Celcius |  | Date: | 2007-02-28 YYYY-MM-DD |  | Plate CH Control (+): | 0.03905±0.00147 |  | Plate DMSO Control (-): | 0.8016749999999999±0.01292 |  | Plate Z-Factor: | 0.9501 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 5 |  |  
 
	
		| 8974 | 
		(2R,3R,4R,5R)-2-(6-amino-2-chloro-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol | 
	 
	
		| 235481 | 
		2-(6-amino-2-chloro-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol | 
	 
	
		| 474900 | 
		(2S,3S,4R,5S)-2-(6-amino-2-chloro-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol | 
	 
	
		| 6603778 | 
		(2R,3R,4R,5S)-2-(6-amino-2-chloro-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol | 
	 
	
		| 11957496 | 
		(2R,4R,5R)-2-(6-amino-2-chloro-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol | 
	 
 
 | internal high similarity DBLink  | Rows returned: 1 |  |   
 |  active | Cluster 9750 | Additional Members: 25 | Rows returned: 4 |  |   
 
 |