Compound Information | SONAR Target prediction | Name: | 2-Chloroadenosine | Unique Identifier: | LAT003B08 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C10ClH12N5O4 | Molecular Weight: | 289.591 g/mol | X log p: | 1.286 (online calculus) | Lipinksi Failures | 0 | TPSA | 49.55 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 9 | Rotatable Bond Count: | 2 | Canonical Smiles: | Nc1nc(Cl)nc2n(cnc12)C1OC(CO)C(O)C1O |
Species: |
4932 |
Condition: |
wt18h |
Replicates: |
2 |
Raw OD Value: r im |
0.7968±0.00148492 |
Normalized OD Score: sc h |
1.0216±0.0132019 |
Z-Score: |
0.6423±0.289109 |
p-Value: |
0.529286 |
Z-Factor: |
-4.41762 |
Fitness Defect: |
0.6362 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | LATCA | Plate Number and Position: | 3|B8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.80 Celcius | Date: | 2007-02-28 YYYY-MM-DD | Plate CH Control (+): | 0.04±0.00167 | Plate DMSO Control (-): | 0.80105±0.01681 | Plate Z-Factor: | 0.9253 |
| png ps pdf |
DBLink | Rows returned: 5 | |
8974 |
(2R,3R,4R,5R)-2-(6-amino-2-chloro-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
235481 |
2-(6-amino-2-chloro-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
474900 |
(2S,3S,4R,5S)-2-(6-amino-2-chloro-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
6603778 |
(2R,3R,4R,5S)-2-(6-amino-2-chloro-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
11957496 |
(2R,4R,5R)-2-(6-amino-2-chloro-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
internal high similarity DBLink | Rows returned: 1 | |
|