| Compound Information | SONAR Target prediction | | Name: | Cycloheximide | | Unique Identifier: | LAT003B03 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C15H23NO4 | | Molecular Weight: | 258.165 g/mol | | X log p: | -0.786 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 51.21 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 5 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | CC1CC(C)C(=O)C(C1)C(O)CC1CC(=O)NC(=O)C1 |
| Species: |
4932 |
| Condition: |
pdr22h |
| Replicates: |
2 |
| Raw OD Value: r im |
0.0400±0.00148492 |
| Normalized OD Score: sc h |
0.0596±0.00380132 |
| Z-Score: |
-37.0306±4.18307 |
| p-Value: |
0 |
| Z-Factor: |
0.922385 |
| Fitness Defect: |
INF |
| Bioactivity Statement: |
Toxic |
| Experimental Conditions | | | Library: | LATCA | | Plate Number and Position: | 3|B3 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.90 Celcius | | Date: | 2007-03-08 YYYY-MM-DD | | Plate CH Control (+): | 0.040175±0.00260 | | Plate DMSO Control (-): | 0.652475±0.01329 | | Plate Z-Factor: | 0.9465 |
|  png
ps
pdf |
| 6610291 |
4-[(2S)-2-[(1S,3S,5S)-3,5-dimethyl-2-oxo-cyclohexyl]-2-hydroxy-ethyl]piperidine-2,6-dione |
| 7059506 |
4-[(2R)-2-[(1S,3R,5R)-3,5-dimethyl-2-oxo-cyclohexyl]-2-hydroxy-ethyl]piperidine-2,6-dione |
| 7059507 |
4-[(2R)-2-[(1S,3R,5S)-3,5-dimethyl-2-oxo-cyclohexyl]-2-hydroxy-ethyl]piperidine-2,6-dione |
| 10685294 |
4-[(2R)-2-[(1S,3S,5S)-3,5-dimethyl-2-oxo-cyclohexyl]-2-hydroxy-ethyl]-1-methyl-piperidine-2,6-dione |
| internal high similarity DBLink | Rows returned: 3 | |
| active | Cluster 1392 | Additional Members: 4 | Rows returned: 1 | |
|
