| Compound Information | SONAR Target prediction |
| Name: | N,N-Hexamethyleneamiloride |
| Unique Identifier: | LAT002H09 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C12ClH18N7O |
| Molecular Weight: | 293.628 g/mol |
| X log p: | -1.366 (online calculus) |
| Lipinksi Failures | 0 |
| TPSA | 45.03 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 8 |
| Rotatable Bond Count: | 4 |
| Canonical Smiles: | NC(=N)NC(=O)c1nc(Cl)c(nc1N)N1CCCCCC1 |
| Found: 5 nonactive as graph: single | with analogs | 1 2 3 4 5 Next >> |
| Species: | 4932 |
| Condition: | pdr18h |
| Replicates: | 2 |
| Raw OD Value: r im | 0.6073±0.0195869 |
| Normalized OD Score: sc h | 0.9611±0.0286352 |
| Z-Score: | -0.9899±0.886195 |
| p-Value: | 0.411198 |
| Z-Factor: | -3.40602 |
| Fitness Defect: | 0.8887 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 0 |
| internal high similarity DBLink | Rows returned: 1 |
| SPE01504215 | 1.0000 |
| active | Cluster 4060 | Additional Members: 8 | Rows returned: 2 |
| SPE01504215 | 0.462962962962963 |
| SPE01500112 | 0 |
Service provided by the
Mike Tyers Laboratory