| Compound Information | SONAR Target prediction |
| Name: | Oxytetracycline |
| Unique Identifier: | LAT002G04 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C22ClH25N2O9 |
| Molecular Weight: | 471.696 g/mol |
| X log p: | 4.063 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 54.45 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 11 |
| Rotatable Bond Count: | 2 |
| Canonical Smiles: | Cl.CN(C)C1C2C(O)C3C(=C(O)C2(O)C(=O)C(C(N)=O)=C1O)C(=O)c1c(O)cccc1C3(C) O |
| Found: 5 nonactive as graph: single | with analogs | 1 2 3 4 5 Next >> |
| Species: | 4932 |
| Condition: | pdr18h |
| Replicates: | 2 |
| Raw OD Value: r im | 0.6386±0.00601041 |
| Normalized OD Score: sc h | 1.0107±0.0120017 |
| Z-Score: | 0.4558±0.368709 |
| p-Value: | 0.659514 |
| Z-Factor: | -7.3806 |
| Fitness Defect: | 0.4163 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 0 |
| internal high similarity DBLink | Rows returned: 2 |
| Prest630 | 1.0000 |
| SPE01500457 | 1.0000 |
| nonactive | Cluster 2358 | Additional Members: 14 | Rows returned: 11 | << Back 1 2 |
| SPE01500457 | 0.353658536585366 |
| LAT001F08 | 0 |
| LOPAC 00868 | 0 |
| LAT003B10 | 0 |
| SPE01500266 | 0 |
Service provided by the
Mike Tyers Laboratory