| Compound Information | SONAR Target prediction |
| Name: | Mebendazole |
| Unique Identifier: | LAT002F08 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C16H13N3O3 |
| Molecular Weight: | 282.19 g/mol |
| X log p: | 16.019 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 55.73 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 6 |
| Rotatable Bond Count: | 5 |
| Canonical Smiles: | COC(=O)Nc1nc2ccc(cc2n1)C(=O)c1ccccc1 |
| Found: 4 active | as graph: single | with analogs | 1 2 3 4 Next >> |
| Species: | 4932 |
| Condition: | pdr18h |
| Replicates: | 2 |
| Raw OD Value: r im | 0.0896±0.00799031 |
| Normalized OD Score: sc h | 0.1418±0.0129959 |
| Z-Score: | -24.1151±1.45663 |
| p-Value: | 0 |
| Z-Factor: | 0.867386 |
| Fitness Defect: | INF |
| Bioactivity Statement: | Toxic |
| ps |
| DBLink | Rows returned: 0 |
| internal high similarity DBLink | Rows returned: 2 |
| Prest310 | 1.0000 |
| SPE01501110 | 1.0000 |
| nonactive | Cluster 3124 | Additional Members: 12 | Rows returned: 8 | 1 2 Next >> |
| 000A-0229 | 0.492063492063492 |
| Prest1169 | 0.483870967741936 |
| Prest675 | 0.46031746031746 |
| 4569-1457 | 0.450704225352113 |
| Prest359 | 0.370967741935484 |
| LOPAC 01029 | 0.370967741935484 |
Service provided by the
Mike Tyers Laboratory