| Compound Information | SONAR Target prediction | | Name: | Phenolphthalein | | Unique Identifier: | LAT002F05 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C20H14O4 | | Molecular Weight: | 304.212 g/mol | | X log p: | 24.435 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 2 | | Canonical Smiles: | Oc1ccc(cc1)C1(OC(=O)c2ccccc21)c1ccc(O)cc1 |
| Species: |
4932 |
| Condition: |
pdr18h |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6444±0.0205061 |
| Normalized OD Score: sc h |
1.0200±0.0349681 |
| Z-Score: |
0.7429±1.03796 |
| p-Value: |
0.566284 |
| Z-Factor: |
-6.98296 |
| Fitness Defect: |
0.5687 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | LATCA | | Plate Number and Position: | 2|F5 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.10 Celcius | | Date: | 2007-03-08 YYYY-MM-DD | | Plate CH Control (+): | 0.03955±0.00248 | | Plate DMSO Control (-): | 0.647475±0.01609 | | Plate Z-Factor: | 0.8987 |
|  png
ps
pdf |
| DBLink | Rows returned: 4 | |
| 4764 |
3,3-bis(4-hydroxyphenyl)isobenzofuran-1-one |
| 68206 |
disodium 4-[1-(4-oxidophenyl)-3-oxo-isobenzofuran-1-yl]phenolate |
| 228383 |
3-(4-hydroxyphenyl)-3-phenyl-isobenzofuran-1-one |
| 343716 |
3-(4-hydroxyphenyl)-3H-isobenzofuran-1-one |
| internal high similarity DBLink | Rows returned: 1 | |
| active | Cluster 5860 | Additional Members: 5 | Rows returned: 1 | |
|
