| Compound Information | SONAR Target prediction | | Name: | Clemastine | | Unique Identifier: | LAT002E10 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C25ClH30NO5 | | Molecular Weight: | 429.724 g/mol | | X log p: | 18.96 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 12.47 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 2 | | Rotatable Bond Count: | 6 | | Canonical Smiles: | CN1CCCC1CCOC(C)(c1ccccc1)c1ccc(Cl)cc1.OC(=O)C=CC(O)=O |
| Species: |
4932 |
| Condition: |
pdr18h |
| Replicates: |
2 |
| Raw OD Value: r im |
0.3057±0.0328805 |
| Normalized OD Score: sc h |
0.4838±0.0532339 |
| Z-Score: |
-14.3986±0.410884 |
| p-Value: |
2.8026e-45 |
| Z-Factor: |
0.544068 |
| Fitness Defect: |
102.5858 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | LATCA | | Plate Number and Position: | 2|E10 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.10 Celcius | | Date: | 2007-03-08 YYYY-MM-DD | | Plate CH Control (+): | 0.03955±0.00248 | | Plate DMSO Control (-): | 0.647475±0.01609 | | Plate Z-Factor: | 0.8987 |
|  png
ps
pdf |
| DBLink | Rows returned: 3 | |
| 26986 |
but-2-enedioic acid; (2R)-2-[2-[(1R)-1-(4-chlorophenyl)-1-phenyl-ethoxy]ethyl]-1-methyl-pyrrolidine |
| 5281069 |
but-2-enedioic acid; (2R)-2-[2-[(1R)-1-(4-chlorophenyl)-1-phenyl-ethoxy]ethyl]-1-methyl-pyrrolidine |
| 6426695 |
(2R)-2-[2-[(1R)-1-(4-chlorophenyl)-1-phenyl-ethoxy]ethyl]-1-methyl-2,3,4,5-tetrahydropyrrole;
(E)-4-hydroxy-4-oxo-but-2-enoate |
| internal high similarity DBLink | Rows returned: 3 | |
| nonactive | Cluster 7676 | Additional Members: 4 | Rows returned: 3 | |
|
