| Compound Information | SONAR Target prediction |
| Name: | Methacycline Hydrochloride |
| Unique Identifier: | LAT002E08 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C22ClH23N2O8 |
| Molecular Weight: | 455.697 g/mol |
| X log p: | 5.229 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 54.45 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 10 |
| Rotatable Bond Count: | 2 |
| Canonical Smiles: | Cl.CN(C)C1C2C(O)C3C(=C)c4cccc(O)c4C(=O)C3=C(O)C2(O)C(=O)C(C(N)=O)=C1O |
| Found: 5 nonactive as graph: single | with analogs | 1 2 3 4 5 Next >> |
| Species: | 4932 |
| Condition: | pdr18h |
| Replicates: | 2 |
| Raw OD Value: r im | 0.6193±0.019304 |
| Normalized OD Score: sc h | 0.9801±0.0281408 |
| Z-Score: | -0.4523±0.831699 |
| p-Value: | 0.59506 |
| Z-Factor: | -8.1273 |
| Fitness Defect: | 0.5191 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 0 |
| internal high similarity DBLink | Rows returned: 2 |
| Prest1251 | 1.0000 |
| SPE01501104 | 1.0000 |
| active | Cluster 2358 | Additional Members: 14 | Rows returned: 5 |
| Prest588 | 0.465909090909091 |
| SPE01501118 | 0.465909090909091 |
| Prest1251 | 0.406976744186046 |
| Prest1072 | 0 |
| SPE01500266 | 0 |
Service provided by the
Mike Tyers Laboratory