| Compound Information | SONAR Target prediction |
| Name: | Flunisolide |
| Unique Identifier: | LAT002D03 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C24FH31O6 |
| Molecular Weight: | 403.252 g/mol |
| X log p: | 3.921 (online calculus) |
| Lipinksi Failures | 0 |
| TPSA | 52.6 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 6 |
| Rotatable Bond Count: | 2 |
| Canonical Smiles: | CC1(C)OC2CC3C4CC(F)C5=CC(=O)C=CC5(C)C4C(O)CC3(C)C2(O1)C(=O)CO |
| Generic_name: | Flunisolide |
| Drug_type: | Approved Drug |
| Pharmgkb_id: | PA449661 |
| Kegg_compound_id: | D00324 |
| Drugbank_id: | APRD00976 |
| Melting_point: | 245 oC |
| H2o_solubility: | Practically insoluble |
| Logp: | 2.9 |
| Cas_registry_number: | 03/03/3385 |
| Drug_category: | Anti-Asthmatic Agents; Anti-Inflammatory Agents; ATC:R01AD04; ATC:R03BA03 |
| Indication: | For the maintenance treatment of asthma as a prophylactic therapy. |
| Pharmacology: | Flunisolide is a synthetic corticosteroid. It is administered either as an oral metered-dose inhaler for the treatment of asthma or as a nasal spray for treating allergic rhinitis. Corticosteroids are naturally occurring hormones that prevent or suppress inflammation and immune responses. When given as an intranasal spray, flunisolide reduces watery nasal discharge (rhinorrhea), nasal congestion, postnasal drip, sneezing, and itching oat the back of the throat that are common allergic symptoms. |
| Mechanism_of_action: | Flunisolide is a glucocorticoid receptor agonist. The antiinflammatory actions of corticosteroids are thought to involve lipocortins, phospholipase A2 inhibitory proteins which, through inhibition arachidonic acid, control the biosynthesis of prostaglandins and leukotrienes. The immune system is suppressed by corticosteroids due to a decrease in the function of the lymphatic system, a reduction in immunoglobulin and complement concentrations, the precipitation of lymphocytopenia, and interference with antigen-antibody binding. Flunisolide binds to plasma transcortin, and it becomes active when it is not bound to transcortin. |
| Organisms_affected: | Humans and other mammals |
| Found: 5 nonactive as graph: single | with analogs | 1 2 3 4 5 Next >> |
| Species: | 4932 |
| Condition: | pdr18h |
| Replicates: | 2 |
| Raw OD Value: r im | 0.6520±0.0136472 |
| Normalized OD Score: sc h | 1.0319±0.0241413 |
| Z-Score: | 1.0689±0.757261 |
| p-Value: | 0.351182 |
| Z-Factor: | -3.26976 |
| Fitness Defect: | 1.0465 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 11 | << Back 1 2 |
| 5702174 |
| 6604458 |
| 6918452 |
| 10478048 |
| 11954221 |
| internal high similarity DBLink | Rows returned: 2 |
| Prest223 | 1.0000 |
| SPE01501187 | 1.0000 |
| active | Cluster 2095 | Additional Members: 14 | Rows returned: 0 |
Service provided by the
Mike Tyers Laboratory