Compound Information | SONAR Target prediction | Name: | Antimycin A | Unique Identifier: | LAT002D02 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C27H38N2O9 | Molecular Weight: | 496.297 g/mol | X log p: | 8.094 (online calculus) | Lipinksi Failures | 3 | TPSA | 113.04 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 11 | Rotatable Bond Count: | 13 | Canonical Smiles: | CCCCCC1C(OC(=O)CC(C)C)C(C)OC(=O)C(NC(=O)c2cccc(NC=O)c2O)C(C)OC1=O |
Species: |
4932 |
Condition: |
wt18h |
Replicates: |
2 |
Raw OD Value: r im |
0.7027±0.0221324 |
Normalized OD Score: sc h |
0.8923±0.0212171 |
Z-Score: |
-2.9529±0.0550404 |
p-Value: |
0.00317124 |
Z-Factor: |
-0.330355 |
Fitness Defect: |
5.7536 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | LATCA | Plate Number and Position: | 2|D2 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.70 Celcius | Date: | 2007-02-28 YYYY-MM-DD | Plate CH Control (+): | 0.040325±0.00180 | Plate DMSO Control (-): | 0.8076749999999999±0.01978 | Plate Z-Factor: | 0.9010 |
| png ps pdf |
5702199 |
[(2R,3S,6S,7R,8R)-3-[(3-formamido-2-hydroxy-benzoyl)amino]-2,6-dimethyl-4,9-dioxo-8-pentyl-1,5-dioxonan- 7-yl] 3-methylbutanoate |
6420045 |
[(2R,6S,7R,8R)-3-[(3-formamido-2-hydroxy-benzoyl)amino]-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl ] 3-methylbutanoate |
6427048 |
[3-[(3-formamido-2-hydroxy-benzoyl)amino]-2,6-dimethyl-4,9-dioxo-8-propyl-1,5-dioxonan-7-yl] 3-methylbutanoate |
6604296 |
[(2R,3S,6S,7S,8R)-3-[(3-formamido-2-hydroxy-benzoyl)amino]-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7 -yl] 3-methylbutanoate |
6604664 |
[(2S,3S,6S,7R,8R)-3-[(3-formamido-2-hydroxy-benzoyl)amino]-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7 -yl] 3-methylbutanoate |
7067442 |
[(2S,3R,6S,7S,8R)-3-[(3-formamido-2-hydroxy-benzoyl)amino]-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7 -yl] 3-methylbutanoate |
internal high similarity DBLink | Rows returned: 3 | |
active | Cluster 5241 | Additional Members: 4 | Rows returned: 1 | |
|