| Compound Information | SONAR Target prediction | | Name: | Antimycin A | | Unique Identifier: | LAT002D02 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C27H38N2O9 | | Molecular Weight: | 496.297 g/mol | | X log p: | 8.094 (online calculus) | | Lipinksi Failures | 3 | | TPSA | 113.04 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 11 | | Rotatable Bond Count: | 13 | | Canonical Smiles: | CCCCCC1C(OC(=O)CC(C)C)C(C)OC(=O)C(NC(=O)c2cccc(NC=O)c2O)C(C)OC1=O |
| Species: |
4932 |
| Condition: |
wt24h |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7730±0.016617 |
| Normalized OD Score: sc h |
0.9422±0.0199857 |
| Z-Score: |
-2.5182±1.64139 |
| p-Value: |
0.087414 |
| Z-Factor: |
-0.79435 |
| Fitness Defect: |
2.4371 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | LATCA | | Plate Number and Position: | 2|D2 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.40 Celcius | | Date: | 2007-02-28 YYYY-MM-DD | | Plate CH Control (+): | 0.04±0.00274 | | Plate DMSO Control (-): | 0.810125±0.01183 | | Plate Z-Factor: | 0.9322 |
|  png
ps
pdf |
| 447892 |
[(2R,3S,6S,7R,8R)-3-[(3-formamido-2-hydroxy-benzoyl)amino]-2,6-dimethyl-4,9-dioxo-8-pentyl-1,5-dioxonan-
7-yl] 2-methylpropanoate |
| 3084471 |
[3-[(3-formamido-2-hydroxy-benzoyl)amino]-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] butanoate |
| 3084472 |
[8-butyl-3-[(3-formamido-2-hydroxy-benzoyl)amino]-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] butanoate |
| 4587175 |
[8-butyl-3-[(3-formamido-2-hydroxy-benzoyl)amino]-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl]
3-methylbutanoate |
| 5287676 |
[(2S,3S,6R,7R,8R)-3-[(3-formamido-2-hydroxy-benzoyl)amino]-2,6-dimethyl-4,9-dioxo-8-pentyl-1,5-dioxonan-
7-yl] 3-methylbutanoate |
| 5287683 |
[(2R,3S,6S,7R,8R)-3-[(3-formamido-2-hydroxy-benzoyl)amino]-8-heptyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-
7-yl] (2R)-2-methylbutanoate |
| internal high similarity DBLink | Rows returned: 3 | |
| active | Cluster 5241 | Additional Members: 4 | Rows returned: 1 | |
|
