Compound Information | SONAR Target prediction | Name: | Piperine | Unique Identifier: | LAT002C09 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C17H19NO3 | Molecular Weight: | 266.187 g/mol | X log p: | 14.992 (online calculus) | Lipinksi Failures | 1 | TPSA | 38.77 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 4 | Canonical Smiles: | O=C(C=CC=Cc1ccc2OCOc2c1)N1CCCCC1 |
Species: |
4932 |
Condition: |
pdr24h |
Replicates: |
2 |
Raw OD Value: r im |
0.7370±0.0195869 |
Normalized OD Score: sc h |
1.0227±0.00292614 |
Z-Score: |
1.0741±0.119995 |
p-Value: |
0.284516 |
Z-Factor: |
-2.81867 |
Fitness Defect: |
1.257 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | LATCA | Plate Number and Position: | 2|C9 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.10 Celcius | Date: | 2007-03-08 YYYY-MM-DD | Plate CH Control (+): | 0.040275000000000005±0.00205 | Plate DMSO Control (-): | 0.692975±0.01342 | Plate Z-Factor: | 0.9255 |
| png ps pdf |
DBLink | Rows returned: 4 | |
4840 |
5-benzo[1,3]dioxol-5-yl-1-(1-piperidyl)penta-2,4-dien-1-one |
638024 |
(2E,4E)-5-benzo[1,3]dioxol-5-yl-1-(1-piperidyl)penta-2,4-dien-1-one |
1548912 |
(2E,4E)-5-benzo[1,3]dioxol-5-yl-1-(1-piperidyl)penta-2,4-dien-1-one |
1548913 |
(2E,4E)-5-benzo[1,3]dioxol-5-yl-1-(1-piperidyl)penta-2,4-dien-1-one |
internal high similarity DBLink | Rows returned: 4 | |
active | Cluster 14706 | Additional Members: 7 | Rows returned: 2 | |
|