| Compound Information | SONAR Target prediction |
| Name: | Flurandrenolide |
| Unique Identifier: | LAT002B11 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C24FH33O6 |
| Molecular Weight: | 403.252 g/mol |
| X log p: | -0.441 (online calculus) |
| Lipinksi Failures | 0 |
| TPSA | 52.6 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 6 |
| Rotatable Bond Count: | 2 |
| Canonical Smiles: | CC1(C)OC2CC3C4CC(F)C5=CC(=O)CCC5(C)C4C(O)CC3(C)C2(O1)C(=O)CO |
| Generic_name: | Flurandrenolide |
| Chemical_iupac_name: | 6-fluoro-11,21 dihydroxy-16,17-[(l-methylethylidene) bis (oxy)]-, (6?, 11?, 16?)- Pregn-4-ene-3,20-dione |
| Drug_type: | Approved Drug |
| Pharmgkb_id: | PA449680 |
| Kegg_compound_id: | D00328 |
| Drugbank_id: | APRD00982 |
| Melting_point: | 251 oC |
| H2o_solubility: | Insoluble |
| Logp: | 2.887 |
| Cas_registry_number: | 1524-88-5 |
| Drug_category: | Anti-Inflammatory Agents; Glucocorticoids |
| Indication: | For relief of the inflammatory and pruritic manifestations of corticosteroid-responsive dermatoses, particularly dry, scaling localized lesions |
| Organisms_affected: | Humans and other mammals |