| Compound Information | SONAR Target prediction |
| Name: | Berberine Chloride |
| Unique Identifier: | LAT002A08 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C20ClH19NO4 |
| Molecular Weight: | 353.671 g/mol |
| X log p: | 15.013 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 39.93 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 4 |
| Rotatable Bond Count: | 2 |
| Canonical Smiles: | [ClH-].COc1ccc2cc3c4cc5OCOc5cc4CC[n+]3cc2c1OC |
| Generic_name: | BERBERINE |
| Chemical_iupac_name: | BERBERINE |
| Drug_type: | Experimental |
| Kegg_compound_id: | C00757 |
| Drugbank_id: | EXPT00672 |
| Logp: | 4.473 |
| Cas_registry_number: | 2086-83-1 |
| Drug_category: | Hypothetical Transcriptional Regulator In Qa inhibitor |
| Organisms_affected: | -1 |
| Found: 4 nonactive | as graph: single | with analogs | 1 2 3 4 Next >> |
| Species: | 4932 |
| Condition: | pdr22h |
| Replicates: | 2 |
| Raw OD Value: r im | 0.6099±0.0200111 |
| Normalized OD Score: sc h | 0.8856±0.0419552 |
| Z-Score: | -4.5173±2.30242 |
| p-Value: | 0.00193061 |
| Z-Factor: | -0.315735 |
| Fitness Defect: | 6.2499 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 12 | 1 2 Next >> |
| 2353 |
| 8340 |
| 12456 |
| 72350 |
| 155071 |
| 155074 |
| internal high similarity DBLink | Rows returned: 3 |
| BIOMOL 38 | 1.0000 |
| Prest91 | 1.0000 |
| SPE01500811 | 1.0000 |
| active | Cluster 10382 | Additional Members: 9 | Rows returned: 4 |
| Prest374 | 0.328358208955224 |
| Prest91 | 0 |
| LAT004G09 | 0 |
| SPE01500811 | 0 |
Service provided by the
Mike Tyers Laboratory