| Compound Information | SONAR Target prediction |
| Name: | Camptothecin |
| Unique Identifier: | LAT002A02 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C20H16N2O4 |
| Molecular Weight: | 332.225 g/mol |
| X log p: | 11.182 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 58.97 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 6 |
| Rotatable Bond Count: | 1 |
| Canonical Smiles: | CCC1(O)C(=O)OCC2C(=O)N3Cc4cc5ccccc5nc4C3=CC=21 |
| Found: 4 active | as graph: single | with analogs | 1 2 3 4 Next >> |
| Species: | 4932 |
| Condition: | pdr18h |
| Replicates: | 2 |
| Raw OD Value: r im | 0.2073±0.00997021 |
| Normalized OD Score: sc h | 0.3281±0.0165884 |
| Z-Score: | -18.8431±0.957673 |
| p-Value: | 0 |
| Z-Factor: | 0.814384 |
| Fitness Defect: | INF |
| Bioactivity Statement: | Active |
| ps |
| DBLink | Rows returned: 7 | << Back 1 2 |
| 10712763 | -1 |
| internal high similarity DBLink | Rows returned: 3 |
| LOPAC 00814 | 1.0000 |
| Prest102 | 1.0000 |
| SPE01502232 | 1.0000 |
| nonactive | Cluster 1530 | Additional Members: 9 | Rows returned: 6 |
| SPE01505821 | 0.535714285714286 |
| SPE01504123 | 0.178082191780822 |
| LOPAC 00814 | 0 |
| SPE01502232 | 0 |
| Prest102 | 0 |
| LAT003C09 | 0 |
Service provided by the
Mike Tyers Laboratory