| Compound Information | SONAR Target prediction |
| Name: | Dihydro-Obliquin |
| Unique Identifier: | LAT001E05 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C14H14O4 |
| Molecular Weight: | 232.147 g/mol |
| X log p: | 9.123 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 44.76 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 4 |
| Rotatable Bond Count: | 1 |
| Canonical Smiles: | CC(C)C1COc2cc3OC(=O)C=Cc3cc2O1 |
| Found: 4 active | as graph: single | with analogs | 1 2 3 4 Next >> |
| Species: | 4932 |
| Condition: | pdr18h |
| Replicates: | 2 |
| Raw OD Value: r im | 0.2117±0.0424971 |
| Normalized OD Score: sc h | 0.3401±0.0632031 |
| Z-Score: | -18.4522±0.386234 |
| p-Value: | 0 |
| Z-Factor: | -1.18807 |
| Fitness Defect: | INF |
| Bioactivity Statement: | Active |
| ps |
| DBLink | Rows returned: 1 |
| 3503044 |
| internal high similarity DBLink | Rows returned: 1 |
| SPE00100543 | 1.0000 |
| nonactive | Cluster 302 | Additional Members: 10 | Rows returned: 7 | << Back 1 2 |
| LAT011B08 | 0 |
Service provided by the
Mike Tyers Laboratory