| Compound Information | SONAR Target prediction |
| Name: | Psoromic Acid |
| Unique Identifier: | LAT001C06 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C18H16O9 |
| Molecular Weight: | 360.187 g/mol |
| X log p: | 3.932 (online calculus) |
| Lipinksi Failures | 0 |
| TPSA | 61.83 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 9 |
| Rotatable Bond Count: | 3 |
| Canonical Smiles: | COc1cc(C(O)=O)c2Oc3c(C(O)O)c(O)cc(C)c3C(=O)Oc2c1C |
| Found: 5 nonactive as graph: single | with analogs | 1 2 3 4 5 Next >> |
| Species: | 4932 |
| Condition: | pdr18h |
| Replicates: | 2 |
| Raw OD Value: r im | 0.6447±0.0079196 |
| Normalized OD Score: sc h | 1.0375±0.00307554 |
| Z-Score: | 1.1981±0.000435432 |
| p-Value: | 0.230864 |
| Z-Factor: | -5.42119 |
| Fitness Defect: | 1.4659 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 1 |
| 3344819 |
| internal high similarity DBLink | Rows returned: 1 |
| SPE01504106 | 1.0000 |
| active | Cluster 8237 | Additional Members: 3 | Rows returned: 2 |
| SPE00200040 | 0.328125 |
| SPE01504106 | 0 |
Service provided by the
Mike Tyers Laboratory