| Compound Information | SONAR Target prediction |
| Name: | Furazolidone |
| Unique Identifier: | LAT001A09 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C8H7N3O5 |
| Molecular Weight: | 218.103 g/mol |
| X log p: | 6.981 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 96.95 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 5 |
| Rotatable Bond Count: | 3 |
| Canonical Smiles: | O=C1OCCN1N=Cc1oc(cc1)N(=O)=O |
| Found: 5 nonactive as graph: single | with analogs | 1 2 3 4 5 Next >> |
| Species: | 4932 |
| Condition: | pdr18h |
| Replicates: | 2 |
| Raw OD Value: r im | 0.5877±0.0255973 |
| Normalized OD Score: sc h | 0.9456±0.0267748 |
| Z-Score: | -1.3704±0.647526 |
| p-Value: | 0.214518 |
| Z-Factor: | -15.7038 |
| Fitness Defect: | 1.5394 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 0 |
| internal high similarity DBLink | Rows returned: 1 |
| SPE01500309 | 1.0000 |
| active | Cluster 4702 | Additional Members: 3 | Rows returned: 2 |
| Prest1067 | 0.36734693877551 |
| SPE01500309 | 0 |
Service provided by the
Mike Tyers Laboratory