Compound Information | SONAR Target prediction | Name: | Betamethasone 17,21-Dipropionate | Unique Identifier: | LAT001A07 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C28FH37O7 | Molecular Weight: | 467.294 g/mol | X log p: | 4.522 (online calculus) | Lipinksi Failures | 0 | TPSA | 86.74 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 7 | Rotatable Bond Count: | 8 | Canonical Smiles: | CCC(=O)OCC(=O)C1(OC(=O)CC)C(C)CC2C3CCC4=CC(=O)C=CC4(C)C3(F)C(O)CC21C |
Species: |
4932 |
Condition: |
pdr24h |
Replicates: |
2 |
Raw OD Value: r im |
0.7211±0.00905097 |
Normalized OD Score: sc h |
0.9949±0.0103522 |
Z-Score: |
-0.1160±0.422799 |
p-Value: |
0.766498 |
Z-Factor: |
-9.05525 |
Fitness Defect: |
0.2659 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | LATCA | Plate Number and Position: | 1|A7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.10 Celcius | Date: | 2007-03-08 YYYY-MM-DD | Plate CH Control (+): | 0.040225±0.00178 | Plate DMSO Control (-): | 0.6901999999999999±0.23283 | Plate Z-Factor: | -0.0802 |
| png ps pdf |
146364 |
[2-[(8S,10S,11S,13S,14S,16S,17R)-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-17-propanoyloxy-6,7,8,11,1 2,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] propanoate |
443880 |
[(8S,9R,10S,11S,13S,14S,16S,17R)-9-fluoro-11-hydroxy-17-(2-methoxyacetyl)-10,13,16-trimethyl-3-oxo-6,7,8 ,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] propanoate |
546807 |
[2-(9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-17-propanoyloxy-6,7,8,11,12,14,15,16-octahydrocyclopent a[a]phenanthren-17-yl)-2-oxo-ethyl] propanoate |
3084694 |
[2-[(8S,9R,10S,11S,13S,14S,16S,17R)-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-17-pentanoyloxy-6,7,8,1 1,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] pentanoate |
3743723 |
[2-(9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-17-pentanoyloxy-6,7,8,11,12,14,15,16-octahydrocyclopent a[a]phenanthren-17-yl)-2-oxo-ethyl] pentanoate |
4630257 |
[17-(2-acetyloxyacetyl)-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclo penta[a]phenanthren-17-yl] 2-methylpropanoate |
internal high similarity DBLink | Rows returned: 1 | |
|