Compound Information | SONAR Target prediction | Name: | 3,7-Dimethoxyflavone | Unique Identifier: | LAT001A05 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C17H14O4 | Molecular Weight: | 268.18 g/mol | X log p: | 17.421 (online calculus) | Lipinksi Failures | 1 | TPSA | 44.76 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 3 | Canonical Smiles: | COc1ccc2C(=O)C(OC)=C(Oc2c1)c1ccccc1 |
Species: |
4932 |
Condition: |
pdr24h |
Replicates: |
2 |
Raw OD Value: r im |
0.7270±0.000353553 |
Normalized OD Score: sc h |
1.0030±0.00264046 |
Z-Score: |
0.2249±0.127457 |
p-Value: |
0.822732 |
Z-Factor: |
-8.12129 |
Fitness Defect: |
0.1951 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | LATCA | Plate Number and Position: | 1|A5 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.10 Celcius | Date: | 2007-03-08 YYYY-MM-DD | Plate CH Control (+): | 0.040225±0.00178 | Plate DMSO Control (-): | 0.6901999999999999±0.23283 | Plate Z-Factor: | -0.0802 |
| png ps pdf |
DBLink | Rows returned: 1 | |
688664 |
3,7-dimethoxy-2-phenyl-chromen-4-one |
internal high similarity DBLink | Rows returned: 1 | |
active | Cluster 16135 | Additional Members: 3 | Rows returned: 2 | |
|