Compound Information | SONAR Target prediction | Name: | 3,7-Dimethoxyflavone | Unique Identifier: | LAT001A05 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C17H14O4 | Molecular Weight: | 268.18 g/mol | X log p: | 17.421 (online calculus) | Lipinksi Failures | 1 | TPSA | 44.76 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 3 | Canonical Smiles: | COc1ccc2C(=O)C(OC)=C(Oc2c1)c1ccccc1 |
Species: |
4932 |
Condition: |
pdr18h |
Replicates: |
2 |
Raw OD Value: r im |
0.5719±0.00657609 |
Normalized OD Score: sc h |
0.9204±0.0246179 |
Z-Score: |
-2.1354±0.859319 |
p-Value: |
0.0663342 |
Z-Factor: |
-26.2344 |
Fitness Defect: |
2.713 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | LATCA | Plate Number and Position: | 1|A5 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.90 Celcius | Date: | 2007-03-08 YYYY-MM-DD | Plate CH Control (+): | 0.040175±0.00183 | Plate DMSO Control (-): | 0.629975±0.20881 | Plate Z-Factor: | -0.0737 |
| png ps pdf |
DBLink | Rows returned: 1 | |
688664 |
3,7-dimethoxy-2-phenyl-chromen-4-one |
internal high similarity DBLink | Rows returned: 1 | |
active | Cluster 16135 | Additional Members: 3 | Rows returned: 2 | |
|