| Compound Information | SONAR Target prediction | | Name: | | | Unique Identifier: | K679-0068 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C18H18N4O2 | | Molecular Weight: | 304.218 g/mol | | X log p: | 13.919 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 62.1 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 6 | | Rotatable Bond Count: | 5 | | Canonical Smiles: | CCN1C=C(C(=O)NCc2cccnc2)C(=O)c2ccc(C)nc12 |
| Species: |
4932 |
| Condition: |
gpr1-2nd |
| Replicates: |
2 |
| Raw OD Value: r im |
0.8232±0.0176777 |
| Normalized OD Score: sc h |
1.0065±0.0303926 |
| Z-Score: |
0.0994±0.755803 |
| p-Value: |
0.594864 |
| Z-Factor: |
-10.6384 |
| Fitness Defect: |
0.5194 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | ChemDiv-Kinase | | Plate Number and Position: | 12|H11 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 0.00 Celcius | | Date: | 2005-08-16 YYYY-MM-DD | | Plate CH Control (+): | 0.045325000000000004±0.00270 | | Plate DMSO Control (-): | 0.815125±0.04363 | | Plate Z-Factor: | 0.9009 |
|  png
ps
pdf |
| DBLink | Rows returned: 1 | |
| 859255 |
1-ethyl-7-methyl-4-oxo-N-(pyridin-3-ylmethyl)-1,8-naphthyridine-3-carboxamide |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 13339 | Additional Members: 8 | Rows returned: 3 | |
|
