| Compound Information | SONAR Target prediction | | Name: | N4-[2-(diethylamino)ethyl]-3-(2,6-dichlorophenyl)-5-methylisoxazole-4- carboxamide | | Unique Identifier: | CD 05285 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C17Cl2H21N3O2 | | Molecular Weight: | 349.106 g/mol | | X log p: | 7.936 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 41.9 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 8 | | Canonical Smiles: | CCN(CC)CCNC(=O)c1c(C)onc1c1c(Cl)cccc1Cl |
| Species: |
4932 |
| Condition: |
ALG12 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6350±0.0255973 |
| Normalized OD Score: sc h |
1.0224±0.0134095 |
| Z-Score: |
0.7839±0.447623 |
| p-Value: |
0.455708 |
| Z-Factor: |
-3.00447 |
| Fitness Defect: |
0.7859 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Maybridge1000 | | Plate Number and Position: | 4|D9 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 0 nm | | Robot Temperature: | 20.60 Celcius | | Date: | 2006-11-01 YYYY-MM-DD | | Plate CH Control (+): | 0.039150000000000004±0.00252 | | Plate DMSO Control (-): | 0.6462±0.01224 | | Plate Z-Factor: | 0.9092 |
| png ps pdf |
| 7039337 |
2-[[3-(2,6-dichlorophenyl)-5-methyl-oxazole-4-carbonyl]amino]ethyl-diethyl-azanium |
| internal high similarity DBLink | Rows returned: 14 | << Back 1 2 3 |
| active | Cluster 8647 | Additional Members: 126 | Rows returned: 4 | |
|