| Compound Information | SONAR Target prediction | | Name: | N4-[2-(diethylamino)ethyl]-3-(2,6-dichlorophenyl)-5-methylisoxazole-4- carboxamide | | Unique Identifier: | CD 05285 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C17Cl2H21N3O2 | | Molecular Weight: | 349.106 g/mol | | X log p: | 7.936 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 41.9 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 8 | | Canonical Smiles: | CCN(CC)CCNC(=O)c1c(C)onc1c1c(Cl)cccc1Cl |
| Species: |
4932 |
| Condition: |
CIN2 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7207±0.0248902 |
| Normalized OD Score: sc h |
1.0147±0.0122391 |
| Z-Score: |
0.4096±0.330911 |
| p-Value: |
0.690254 |
| Z-Factor: |
-5.28896 |
| Fitness Defect: |
0.3707 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Maybridge1000 | | Plate Number and Position: | 4|D9 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 0 nm | | Robot Temperature: | 21.20 Celcius | | Date: | 2006-10-27 YYYY-MM-DD | | Plate CH Control (+): | 0.04055±0.00205 | | Plate DMSO Control (-): | 0.76265±0.02528 | | Plate Z-Factor: | 0.9358 |
| png ps pdf |
| 3462950 |
[4-[3-(2-chlorophenyl)-5-methyl-oxazole-4-carbonyl]piperazin-1-yl]-[3-(2-chlorophenyl)-5-methyl-oxazol-4 -yl]methanone |
| 3555310 |
4-[3-(2-chlorophenyl)-5-methyl-oxazole-4-carbonyl]piperazine-1-carbaldehyde |
| 3678282 |
[3-(2-chlorophenyl)-5-methyl-oxazol-4-yl]-(4-methyl-2,3,5,6-tetrahydropyrazin-1-yl)methanone |
| 4050039 |
[3-(2-chlorophenyl)-5-methyl-oxazol-4-yl]-(4-ethyl-2,3,5,6-tetrahydropyrazin-1-yl)methanone |
| 4622385 |
[3-(2,6-dichlorophenyl)-5-methyl-oxazol-4-yl]-(4-methyl-2,3,5,6-tetrahydropyrazin-1-yl)methanone |
| 4758052 |
[3-(2,6-dichlorophenyl)-5-methyl-oxazol-4-yl]-(4-ethyl-2,3,5,6-tetrahydropyrazin-1-yl)methanone |
| internal high similarity DBLink | Rows returned: 14 | 1 2 3 Next >> |
| active | Cluster 8647 | Additional Members: 126 | Rows returned: 4 | |
|