Compound Information | SONAR Target prediction | Name: | CYCLOHEXIMIDE | Unique Identifier: | BIOMOL 98 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C15H23NO4 | Molecular Weight: | 259.173 g/mol | X log p: | -1.079 (online calculus) | Lipinksi Failures | 0 | TPSA | 51.21 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 3 | Canonical Smiles: | CC1CC(C)C(=O)C(C1)C(O)CC1CC(=O)NC(=O)C1 |
Species: |
|
Condition: |
|
Replicates: |
|
Raw OD Value: r im |
± |
Normalized OD Score: sc h |
± |
Z-Score: |
± |
p-Value: |
|
Z-Factor: |
|
Fitness Defect: |
INF |
Bioactivity Statement: |
Toxic |
Experimental Conditions | | Library: | | Plate Number and Position: | | | Drug Concentration: | nM | OD Absorbance: | nm | Robot Temperature: | Celcius | Date: | YYYY-MM-DD | Plate CH Control (+): | ± | Plate DMSO Control (-): | ± | Plate Z-Factor: | |
| png ps pdf |
6610291 |
4-[(2S)-2-[(1S,3S,5S)-3,5-dimethyl-2-oxo-cyclohexyl]-2-hydroxy-ethyl]piperidine-2,6-dione |
7059506 |
4-[(2R)-2-[(1S,3R,5R)-3,5-dimethyl-2-oxo-cyclohexyl]-2-hydroxy-ethyl]piperidine-2,6-dione |
7059507 |
4-[(2R)-2-[(1S,3R,5S)-3,5-dimethyl-2-oxo-cyclohexyl]-2-hydroxy-ethyl]piperidine-2,6-dione |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 1392 | Additional Members: 4 | Rows returned: 2 | |
|