| Compound Information | SONAR Target prediction | | Name: | CYCLOHEXIMIDE | | Unique Identifier: | BIOMOL 98 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C15H23NO4 | | Molecular Weight: | 259.173 g/mol | | X log p: | -1.079 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 51.21 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 5 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | CC1CC(C)C(=O)C(C1)C(O)CC1CC(=O)NC(=O)C1 |
| Species: |
|
| Condition: |
|
| Replicates: |
|
| Raw OD Value: r im |
± |
| Normalized OD Score: sc h |
± |
| Z-Score: |
± |
| p-Value: |
|
| Z-Factor: |
|
| Fitness Defect: |
INF |
| Bioactivity Statement: |
Toxic |
| Experimental Conditions | | | Library: | | | Plate Number and Position: | | | | Drug Concentration: | nM | | OD Absorbance: | nm | | Robot Temperature: | Celcius | | Date: | YYYY-MM-DD | | Plate CH Control (+): | ± | | Plate DMSO Control (-): | ± | | Plate Z-Factor: | |
| png ps pdf |
| 6610291 |
4-[(2S)-2-[(1S,3S,5S)-3,5-dimethyl-2-oxo-cyclohexyl]-2-hydroxy-ethyl]piperidine-2,6-dione |
| 7059506 |
4-[(2R)-2-[(1S,3R,5R)-3,5-dimethyl-2-oxo-cyclohexyl]-2-hydroxy-ethyl]piperidine-2,6-dione |
| 7059507 |
4-[(2R)-2-[(1S,3R,5S)-3,5-dimethyl-2-oxo-cyclohexyl]-2-hydroxy-ethyl]piperidine-2,6-dione |
| internal high similarity DBLink | Rows returned: 0 | |
| nonactive | Cluster 1392 | Additional Members: 4 | Rows returned: 2 | |
|