| Compound Information | SONAR Target prediction | | Name: | CANTHARIDIN | | Unique Identifier: | BIOMOL 62 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C10H12O4 | | Molecular Weight: | 184.105 g/mol | | X log p: | -1.539 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 52.6 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 0 | | Canonical Smiles: | CC12C3CCC(O3)C1(C)C(=O)OC2=O |
| Species: |
|
| Condition: |
|
| Replicates: |
|
| Raw OD Value: r im |
± |
| Normalized OD Score: sc h |
± |
| Z-Score: |
± |
| p-Value: |
|
| Z-Factor: |
|
| Fitness Defect: |
INF |
| Bioactivity Statement: |
Toxic |
| Experimental Conditions | | | Library: | | | Plate Number and Position: | | | | Drug Concentration: | nM | | OD Absorbance: | nm | | Robot Temperature: | Celcius | | Date: | YYYY-MM-DD | | Plate CH Control (+): | ± | | Plate DMSO Control (-): | ± | | Plate Z-Factor: | |
|  png
ps
pdf |
| internal high similarity DBLink | Rows returned: 0 | |
| nonactive | Cluster 4981 | Additional Members: 6 | Rows returned: 5 | |
|
