Compound Information | SONAR Target prediction | Name: | PIPERINE | Unique Identifier: | BIOMOL 347 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C17H19NO3 | Molecular Weight: | 266.187 g/mol | X log p: | 14.992 (online calculus) | Lipinksi Failures | 1 | TPSA | 38.77 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 4 | Canonical Smiles: | O=C(C=CC=Cc1ccc2OCOc2c1)N1CCCCC1 |
Species: |
|
Condition: |
|
Replicates: |
|
Raw OD Value: r im |
± |
Normalized OD Score: sc h |
± |
Z-Score: |
± |
p-Value: |
|
Z-Factor: |
|
Fitness Defect: |
INF |
Bioactivity Statement: |
Toxic |
Experimental Conditions | | Library: | | Plate Number and Position: | | | Drug Concentration: | nM | OD Absorbance: | nm | Robot Temperature: | Celcius | Date: | YYYY-MM-DD | Plate CH Control (+): | ± | Plate DMSO Control (-): | ± | Plate Z-Factor: | |
| png ps pdf |
DBLink | Rows returned: 4 | |
4840 |
5-benzo[1,3]dioxol-5-yl-1-(1-piperidyl)penta-2,4-dien-1-one |
638024 |
(2E,4E)-5-benzo[1,3]dioxol-5-yl-1-(1-piperidyl)penta-2,4-dien-1-one |
1548912 |
(2E,4E)-5-benzo[1,3]dioxol-5-yl-1-(1-piperidyl)penta-2,4-dien-1-one |
1548913 |
(2E,4E)-5-benzo[1,3]dioxol-5-yl-1-(1-piperidyl)penta-2,4-dien-1-one |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 14706 | Additional Members: 7 | Rows returned: 2 | |
|