Compound Information | SONAR Target prediction | Name: | ANTIMYCIN A1 | Unique Identifier: | BIOMOL 15 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C28H40N2O9 | Molecular Weight: | 508.308 g/mol | X log p: | 8.094 (online calculus) | Lipinksi Failures | 3 | TPSA | 113.04 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 11 | Rotatable Bond Count: | 14 | Canonical Smiles: | CCCCCCC1C(OC(=O)CC(C)C)C(C)OC(=O)C(NC(=O)c2cccc(NC=O)c2O)C(C)OC1=O |
Species: |
|
Condition: |
|
Replicates: |
|
Raw OD Value: r im |
± |
Normalized OD Score: sc h |
± |
Z-Score: |
± |
p-Value: |
|
Z-Factor: |
|
Fitness Defect: |
INF |
Bioactivity Statement: |
Toxic |
Experimental Conditions | | Library: | | Plate Number and Position: | | | Drug Concentration: | nM | OD Absorbance: | nm | Robot Temperature: | Celcius | Date: | YYYY-MM-DD | Plate CH Control (+): | ± | Plate DMSO Control (-): | ± | Plate Z-Factor: | |
| png ps pdf |
2204 |
[3-[(3-formamido-2-hydroxy-benzoyl)amino]-2,6-dimethyl-4,9-dioxo-8-pentyl-1,5-dioxonan-7-yl] 3-methylbutanoate |
10652 |
[(6S,7S,8R)-8-butyl-3-[(3-formamido-2-hydroxy-benzoyl)amino]-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] 3-methylbutanoate |
12550 |
[3-[(3-formamido-2-hydroxy-benzoyl)amino]-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] 3-methylbutanoate |
14957 |
[(2R,3S,6S,7R,8R)-3-[(3-formamido-2-hydroxy-benzoyl)amino]-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7 -yl] 3-methylbutanoate |
245869 |
[(2R,3S,6S,7R,8R)-8-butyl-3-[(3-formamido-2-hydroxy-benzoyl)amino]-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7 -yl] 3-methylbutanoate |
447434 |
[(2R,3S,6S,7R,8R)-3-[(3-formamido-2-hydroxy-benzoyl)amino]-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7 -yl] 2-methylpropanoate |
internal high similarity DBLink | Rows returned: 0 | |
nonactive | Cluster 5241 | Additional Members: 4 | Rows returned: 3 | |
|