| Compound Information | SONAR Target prediction | | Name: | ANTIMYCIN A1 | | Unique Identifier: | BIOMOL 15 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C28H40N2O9 | | Molecular Weight: | 508.308 g/mol | | X log p: | 8.094 (online calculus) | | Lipinksi Failures | 3 | | TPSA | 113.04 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 11 | | Rotatable Bond Count: | 14 | | Canonical Smiles: | CCCCCCC1C(OC(=O)CC(C)C)C(C)OC(=O)C(NC(=O)c2cccc(NC=O)c2O)C(C)OC1=O |
| Species: |
|
| Condition: |
|
| Replicates: |
|
| Raw OD Value: r im |
± |
| Normalized OD Score: sc h |
± |
| Z-Score: |
± |
| p-Value: |
|
| Z-Factor: |
|
| Fitness Defect: |
INF |
| Bioactivity Statement: |
Toxic |
| Experimental Conditions | | | Library: | | | Plate Number and Position: | | | | Drug Concentration: | nM | | OD Absorbance: | nm | | Robot Temperature: | Celcius | | Date: | YYYY-MM-DD | | Plate CH Control (+): | ± | | Plate DMSO Control (-): | ± | | Plate Z-Factor: | |
| png ps pdf |
| 447892 |
[(2R,3S,6S,7R,8R)-3-[(3-formamido-2-hydroxy-benzoyl)amino]-2,6-dimethyl-4,9-dioxo-8-pentyl-1,5-dioxonan- 7-yl] 2-methylpropanoate |
| 3084471 |
[3-[(3-formamido-2-hydroxy-benzoyl)amino]-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] butanoate |
| 3084472 |
[8-butyl-3-[(3-formamido-2-hydroxy-benzoyl)amino]-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] butanoate |
| 4587175 |
[8-butyl-3-[(3-formamido-2-hydroxy-benzoyl)amino]-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] 3-methylbutanoate |
| 5287676 |
[(2S,3S,6R,7R,8R)-3-[(3-formamido-2-hydroxy-benzoyl)amino]-2,6-dimethyl-4,9-dioxo-8-pentyl-1,5-dioxonan- 7-yl] 3-methylbutanoate |
| 5287683 |
[(2R,3S,6S,7R,8R)-3-[(3-formamido-2-hydroxy-benzoyl)amino]-8-heptyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan- 7-yl] (2R)-2-methylbutanoate |
| internal high similarity DBLink | Rows returned: 0 | |
| nonactive | Cluster 5241 | Additional Members: 4 | Rows returned: 3 | |
|