Compound Information | SONAR Target prediction | Name: | | Unique Identifier: | 8014-1474 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C11H15N5O5 | Molecular Weight: | 282.148 g/mol | X log p: | 2.655 (online calculus) | Lipinksi Failures | 0 | TPSA | 49.55 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 10 | Rotatable Bond Count: | 2 | Canonical Smiles: | Nc1ncnc2n(cnc12)C1OC(CO)C(O)C(O)C1O |
Species: |
4932 |
Condition: |
rpl9-2nd |
Replicates: |
2 |
Raw OD Value: r im |
0.7616±0.197212 |
Normalized OD Score: sc h |
0.9730±0.00759405 |
Z-Score: |
-0.8525±0.276566 |
p-Value: |
0.40289 |
Z-Factor: |
-2.82252 |
Fitness Defect: |
0.9091 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | ChemDiv-Kinase | Plate Number and Position: | 10|C10 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 0.00 Celcius | Date: | 2005-08-16 YYYY-MM-DD | Plate CH Control (+): | 0.044125±0.00211 | Plate DMSO Control (-): | 0.761525±0.02352 | Plate Z-Factor: | 0.9120 |
| png ps pdf |
DBLink | Rows returned: 6 | |
240186 |
2-(6-aminopurin-9-yl)-6-(hydroxymethyl)oxane-3,4,5-triol |
276156 |
2-(6-aminopurin-9-yl)-6-methyl-oxane-3,4,5-triol |
7124536 |
(2S,3R,4R,5R,6S)-2-(6-aminopurin-9-yl)-6-(hydroxymethyl)oxane-3,4,5-triol |
7124539 |
(2R,3R,4R,5R,6S)-2-(6-aminopurin-9-yl)-6-(hydroxymethyl)oxane-3,4,5-triol |
7124544 |
(2S,3S,4R,5R,6S)-2-(6-aminopurin-9-yl)-6-(hydroxymethyl)oxane-3,4,5-triol |
7124547 |
(2R,3S,4R,5R,6S)-2-(6-aminopurin-9-yl)-6-(hydroxymethyl)oxane-3,4,5-triol |
internal high similarity DBLink | Rows returned: 2 | |
|