| Compound Information | SONAR Target prediction | | Name: | | | Unique Identifier: | 8014-1474 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C11H15N5O5 | | Molecular Weight: | 282.148 g/mol | | X log p: | 2.655 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 49.55 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 10 | | Rotatable Bond Count: | 2 | | Canonical Smiles: | Nc1ncnc2n(cnc12)C1OC(CO)C(O)C(O)C1O |
| Species: |
4932 |
| Condition: |
gpr1-2nd |
| Replicates: |
2 |
| Raw OD Value: r im |
0.8036±0.0116673 |
| Normalized OD Score: sc h |
0.9926±0.0175039 |
| Z-Score: |
-0.1528±0.418715 |
| p-Value: |
0.769798 |
| Z-Factor: |
-75.7399 |
| Fitness Defect: |
0.2616 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | ChemDiv-Kinase | | Plate Number and Position: | 10|C10 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 0.00 Celcius | | Date: | 2005-08-16 YYYY-MM-DD | | Plate CH Control (+): | 0.0444±0.00240 | | Plate DMSO Control (-): | 0.815±0.02239 | | Plate Z-Factor: | 0.9080 |
|  png
ps
pdf |
| DBLink | Rows returned: 6 | |
| 240186 |
2-(6-aminopurin-9-yl)-6-(hydroxymethyl)oxane-3,4,5-triol |
| 276156 |
2-(6-aminopurin-9-yl)-6-methyl-oxane-3,4,5-triol |
| 7124536 |
(2S,3R,4R,5R,6S)-2-(6-aminopurin-9-yl)-6-(hydroxymethyl)oxane-3,4,5-triol |
| 7124539 |
(2R,3R,4R,5R,6S)-2-(6-aminopurin-9-yl)-6-(hydroxymethyl)oxane-3,4,5-triol |
| 7124544 |
(2S,3S,4R,5R,6S)-2-(6-aminopurin-9-yl)-6-(hydroxymethyl)oxane-3,4,5-triol |
| 7124547 |
(2R,3S,4R,5R,6S)-2-(6-aminopurin-9-yl)-6-(hydroxymethyl)oxane-3,4,5-triol |
| internal high similarity DBLink | Rows returned: 2 | |
| active | Cluster 9750 | Additional Members: 25 | Rows returned: 4 | |
|
