Compound Information | SONAR Target prediction | Name: | | Unique Identifier: | 2188-2624 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C18H14O6 | Molecular Weight: | 312.189 g/mol | X log p: | 13.425 (online calculus) | Lipinksi Failures | 1 | TPSA | 44.76 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 6 | Rotatable Bond Count: | 1 | Canonical Smiles: | Oc1cc(O)c2C(=O)C(=COc2c1)c1ccc2OCCCOc2c1 |
Species: |
4932 |
Condition: |
tep1-2nd |
Replicates: |
2 |
Raw OD Value: r im |
0.7604±0.138239 |
Normalized OD Score: sc h |
0.9652±0.00596743 |
Z-Score: |
-0.8120±0.186366 |
p-Value: |
0.420842 |
Z-Factor: |
-5.27127 |
Fitness Defect: |
0.8655 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | ChemDiv-Kinase | Plate Number and Position: | 3|B5 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 0.00 Celcius | Date: | 2005-08-16 YYYY-MM-DD | Plate CH Control (+): | 0.042825±0.00181 | Plate DMSO Control (-): | 0.708575±0.03514 | Plate Z-Factor: | 0.8226 |
| png ps pdf |
DBLink | Rows returned: 1 | |
5413007 |
3-(2,6-dioxabicyclo[5.4.0]undeca-8,10,12-trien-10-yl)-5,7-dihydroxy-chromen-4-one |
internal high similarity DBLink | Rows returned: 1 | |
active | Cluster 14679 | Additional Members: 9 | Rows returned: 5 | |
|