| Compound Information | SONAR Target prediction | | Name: | | | Unique Identifier: | 2188-2624 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C18H14O6 | | Molecular Weight: | 312.189 g/mol | | X log p: | 13.425 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 44.76 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 6 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | Oc1cc(O)c2C(=O)C(=COc2c1)c1ccc2OCCCOc2c1 |
| Species: |
4932 |
| Condition: |
gpr1-2nd |
| Replicates: |
2 |
| Raw OD Value: r im |
0.8181±0.0146371 |
| Normalized OD Score: sc h |
0.9651±0.00913096 |
| Z-Score: |
-0.8798±0.0797357 |
| p-Value: |
0.37973 |
| Z-Factor: |
-6.10876 |
| Fitness Defect: |
0.9683 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | ChemDiv-Kinase | | Plate Number and Position: | 3|B5 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 0.00 Celcius | | Date: | 2005-08-16 YYYY-MM-DD | | Plate CH Control (+): | 0.04515000000000001±0.00356 | | Plate DMSO Control (-): | 0.86605±0.03579 | | Plate Z-Factor: | 0.9060 |
| png ps pdf |
| DBLink | Rows returned: 1 | |
| 5413007 |
3-(2,6-dioxabicyclo[5.4.0]undeca-8,10,12-trien-10-yl)-5,7-dihydroxy-chromen-4-one |
| internal high similarity DBLink | Rows returned: 1 | |
| active | Cluster 14679 | Additional Members: 9 | Rows returned: 5 | |
|